EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO4S |
| Net Charge | 0 |
| Average Mass | 271.338 |
| Monoisotopic Mass | 271.08783 |
| SMILES | COCC(C)N(C(=O)C(=O)O)c1c(C)csc1C |
| InChI | InChI=1S/C12H17NO4S/c1-7-6-18-9(3)10(7)13(8(2)5-17-4)11(14)12(15)16/h6,8H,5H2,1-4H3,(H,15,16) |
| InChIKey | HOYCASTVMCEOTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethenamid OXA (CHEBI:83460) has role marine xenobiotic metabolite (CHEBI:83399) |
| dimethenamid OXA (CHEBI:83460) is a aromatic amide (CHEBI:62733) |
| dimethenamid OXA (CHEBI:83460) is a ether (CHEBI:25698) |
| dimethenamid OXA (CHEBI:83460) is a monocarboxylic acid (CHEBI:25384) |
| dimethenamid OXA (CHEBI:83460) is a thiophenes (CHEBI:26961) |
| Synonym | Source |
|---|---|
| [(2,4-dimethylthiophen-3-yl)(1-methoxypropan-2-yl)amino](oxo)acetic acid | ChEBI |