EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N3 |
| Net Charge | 0 |
| Average Mass | 133.154 |
| Monoisotopic Mass | 133.06400 |
| SMILES | Cc1ccc2nnnc2c1 |
| InChI | InChI=1S/C7H7N3/c1-5-2-3-6-7(4-5)9-10-8-6/h2-4H,1H3,(H,8,9,10) |
| InChIKey | LRUDIIUSNGCQKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-1H-benzotriazole (CHEBI:83455) has role environmental contaminant (CHEBI:78298) |
| 5-methyl-1H-benzotriazole (CHEBI:83455) has role xenobiotic (CHEBI:35703) |
| 5-methyl-1H-benzotriazole (CHEBI:83455) is a benzotriazoles (CHEBI:48912) |
| IUPAC Name |
|---|
| 5-methyl-1H-benzotriazole |
| Synonyms | Source |
|---|---|
| 5-Tolyltriazole | NIST Chemistry WebBook |
| Tolutriazole | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:116658 | Reaxys |
| CAS:136-85-6 | NIST Chemistry WebBook |
| Citations |
|---|