EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O5 |
| Net Charge | 0 |
| Average Mass | 224.212 |
| Monoisotopic Mass | 224.06847 |
| SMILES | O=C1CC(C(=O)O)CC(=O)C1=C(O)C1CC1 |
| InChI | InChI=1S/C11H12O5/c12-7-3-6(11(15)16)4-8(13)9(7)10(14)5-1-2-5/h5-6,14H,1-4H2,(H,15,16)/b10-9- |
| InChIKey | DFFWZNDCNBOKDI-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | gibberellin biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of gibberellins. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| Application: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trinexapac (CHEBI:83454) has role agrochemical (CHEBI:33286) |
| trinexapac (CHEBI:83454) has role gibberellin biosynthesis inhibitor (CHEBI:73193) |
| trinexapac (CHEBI:83454) has role marine xenobiotic metabolite (CHEBI:83399) |
| trinexapac (CHEBI:83454) has role plant growth regulator (CHEBI:26155) |
| trinexapac (CHEBI:83454) is a cyclohexanones (CHEBI:23482) |
| trinexapac (CHEBI:83454) is a cyclopropanes (CHEBI:51454) |
| trinexapac (CHEBI:83454) is a enol (CHEBI:33823) |
| trinexapac (CHEBI:83454) is a monocarboxylic acid (CHEBI:25384) |
| trinexapac (CHEBI:83454) is a β-hydroxy ketone (CHEBI:55380) |
| Incoming Relation(s) |
| trinexapac-ethyl (CHEBI:81817) has functional parent trinexapac (CHEBI:83454) |
| IUPAC Name |
|---|
| 4-[cyclopropyl(hydroxy)methylidene]-3,5-dioxocyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 4-(cyclopropylhydroxymethylene)-3,5-dioxocyclohexanecarboxylic acid | Alan Wood's Pesticides |
| cimectacarb | Alan Wood's Pesticides |
| cimetacarb | Alan Wood's Pesticides |
| (RS)-4-cyclopropyl(hydroxy)methylene-3,5-dioxocyclohexanecarboxylic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| trinexapac | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11657039 | Reaxys |
| CAS:104273-73-6 | Alan Wood's Pesticides |
| CAS:104273-73-6 | ChemIDplus |
| CAS:143294-89-7 | ChemIDplus |
| Citations |
|---|