EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO5S |
| Net Charge | 0 |
| Average Mass | 315.391 |
| Monoisotopic Mass | 315.11404 |
| SMILES | CCOCN(C(=O)CS(=O)(=O)O)c1c(C)cccc1CC |
| InChI | InChI=1S/C14H21NO5S/c1-4-12-8-6-7-11(3)14(12)15(10-20-5-2)13(16)9-21(17,18)19/h6-8H,4-5,9-10H2,1-3H3,(H,17,18,19) |
| InChIKey | HXAIQOCRALNGKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetochlor ESA (CHEBI:83452) has role marine xenobiotic metabolite (CHEBI:83399) |
| acetochlor ESA (CHEBI:83452) is a aromatic amide (CHEBI:62733) |
| acetochlor ESA (CHEBI:83452) is a ether (CHEBI:25698) |
| acetochlor ESA (CHEBI:83452) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| 2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxoethanesulfonic acid |
| Synonym | Source |
|---|---|
| acetochlor ethanesulfonic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7826743 | Reaxys |
| Citations |
|---|