EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO4 |
| Net Charge | 0 |
| Average Mass | 265.309 |
| Monoisotopic Mass | 265.13141 |
| SMILES | CCOCN(C(=O)C(=O)O)c1c(C)cccc1CC |
| InChI | InChI=1S/C14H19NO4/c1-4-11-8-6-7-10(3)12(11)15(9-19-5-2)13(16)14(17)18/h6-8H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | OTKTUNJJKYTOFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetochlor OXA (CHEBI:83451) has role marine xenobiotic metabolite (CHEBI:83399) |
| acetochlor OXA (CHEBI:83451) is a aromatic amide (CHEBI:62733) |
| acetochlor OXA (CHEBI:83451) is a ether (CHEBI:25698) |
| acetochlor OXA (CHEBI:83451) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [(ethoxymethyl)(2-ethyl-6-methylphenyl)amino](oxo)acetic acid |
| Synonym | Source |
|---|---|
| acetochlor oxanilic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7819652 | Reaxys |
| Citations |
|---|