EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25F3N8O |
| Net Charge | 0 |
| Average Mass | 522.535 |
| Monoisotopic Mass | 522.21034 |
| SMILES | O=C(Nc1ccc(Nc2nccc(Nc3cc(C4CCCC4)nn3)n2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H25F3N8O/c27-26(28,29)17-6-3-7-20(14-17)33-25(38)32-19-10-8-18(9-11-19)31-24-30-13-12-22(35-24)34-23-15-21(36-37-23)16-4-1-2-5-16/h3,6-16H,1-2,4-5H2,(H2,32,33,38)(H3,30,31,34,35,36,37) |
| InChIKey | GBMIFBVLJSCVJT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CD532 (CHEBI:83432) has role antineoplastic agent (CHEBI:35610) |
| CD532 (CHEBI:83432) is a aminopyrimidine (CHEBI:38338) |
| CD532 (CHEBI:83432) is a cyclopentanes (CHEBI:23493) |
| CD532 (CHEBI:83432) is a phenylureas (CHEBI:134043) |
| CD532 (CHEBI:83432) is a pyrazoles (CHEBI:26410) |
| CD532 (CHEBI:83432) is a secondary amino compound (CHEBI:50995) |
| Synonyms | Source |
|---|---|
| CD-532 | ChEBI |
| CD 532 | ChEBI |
| 1-[4-({4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl}amino)phenyl]-3-[3-(trifluoromethyl)phenyl]urea | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CJ5 | PDBeChem |
| Citations |
|---|