EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO5P |
| Net Charge | -1 |
| Average Mass | 206.114 |
| Monoisotopic Mass | 206.02238 |
| SMILES | [NH3+]Cc1cc(COP(=O)([O-])[O-])co1 |
| InChI | InChI=1S/C6H10NO5P/c7-2-6-1-5(3-11-6)4-12-13(8,9)10/h1,3H,2,4,7H2,(H2,8,9,10)/p-1 |
| InChIKey | UAFNGMRXHNAKEN-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [5-(ammoniomethyl)-3-furyl]methyl phosphate(1−) (CHEBI:83431) is a organophosphate oxoanion (CHEBI:58945) |
| [5-(ammoniomethyl)-3-furyl]methyl phosphate(1−) (CHEBI:83431) is conjugate base of [5-(aminomethyl)-3-furyl]methyl phosphate (CHEBI:84217) |
| Incoming Relation(s) |
| [5-(aminomethyl)-3-furyl]methyl phosphate (CHEBI:84217) is conjugate acid of [5-(ammoniomethyl)-3-furyl]methyl phosphate(1−) (CHEBI:83431) |
| IUPAC Name |
|---|
| [5-(azaniumylmethyl)-3-furyl]methyl phosphate |
| Synonyms | Source |
|---|---|
| 5-(aminomethyl)-3-furanmethanol phosphate | SUBMITTER |
| 3-(hydroxymethyl)-5-furanammoniomethyl phosphate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| [5-(aminomethyl)-3-furyl]methyl phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7644 | MetaCyc |
| Citations |
|---|