EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O6 |
| Net Charge | 0 |
| Average Mass | 268.225 |
| Monoisotopic Mass | 268.06954 |
| SMILES | O=C(O)C/N=C\C=C1\C=C(C(=O)O)N[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H12N2O6/c14-9(15)5-12-2-1-6-3-7(10(16)17)13-8(4-6)11(18)19/h1-3,8,13H,4-5H2,(H,14,15)(H,16,17)(H,18,19)/b6-1-,12-2-/t8-/m0/s1 |
| InChIKey | ZZZQMKRQWYRKFG-HVXFQPPXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Portulacaxanthin III (CHEBI:8342) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Portulacaxanthin III | KEGG COMPOUND |