EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O7 |
| Net Charge | 0 |
| Average Mass | 374.349 |
| Monoisotopic Mass | 374.11140 |
| SMILES | O=C(O)C1=C/C(=C/C=N\[C@@H](Cc2ccc(O)cc2)C(=O)O)C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C18H18N2O7/c21-12-3-1-10(2-4-12)7-13(16(22)23)19-6-5-11-8-14(17(24)25)20-15(9-11)18(26)27/h1-6,8,13,15,20-21H,7,9H2,(H,22,23)(H,24,25)(H,26,27)/b11-5-,19-6-/t13-,15-/m0/s1 |
| InChIKey | MBFJCQLVRQZZOV-MRHCINOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22624806) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Portulacaxanthin II (CHEBI:8341) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Portulacaxanthin II | KEGG COMPOUND |
| (4E)-4-[(2E)-2-{[1-carboxy-2-(4-hydroxyphenyl)ethyl]imino}ethylidene]-1,2,3,4-tetrahydropyridine-2,6-dicarboxylic acid | HMDB |
| Tyrosine-betaxanthin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C08565 | KEGG COMPOUND |
| C00001604 | KNApSAcK |
| CPD-8670 | MetaCyc |
| HMDB0012281 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:135545-98-1 | KEGG COMPOUND |
| Citations |
|---|