EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2 |
| Net Charge | 0 |
| Average Mass | 334.379 |
| Monoisotopic Mass | 334.14298 |
| SMILES | OCCn1cc(-c2ccc3c(c2)CC/C3=N\O)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C19H18N4O2/c24-10-9-23-12-17(19(21-23)13-5-7-20-8-6-13)15-1-3-16-14(11-15)2-4-18(16)22-25/h1,3,5-8,11-12,24-25H,2,4,9-10H2/b22-18+ |
| InChIKey | DEZZLWQELQORIU-RELWKKBWSA-N |
| Roles Classification |
|---|
| Biological Role: | B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDC-0879 (CHEBI:83405) has role antineoplastic agent (CHEBI:35610) |
| GDC-0879 (CHEBI:83405) has role B-Raf inhibitor (CHEBI:75047) |
| GDC-0879 (CHEBI:83405) is a indanes (CHEBI:46940) |
| GDC-0879 (CHEBI:83405) is a ketoxime (CHEBI:24983) |
| GDC-0879 (CHEBI:83405) is a primary alcohol (CHEBI:15734) |
| GDC-0879 (CHEBI:83405) is a pyrazoles (CHEBI:26410) |
| GDC-0879 (CHEBI:83405) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-{4-[(1E)-1-(hydroxyimino)-2,3-dihydro-1H-inden-5-yl]-3-(pyridin-4-yl)-1H-pyrazol-1-yl}ethanol |
| Manual Xrefs | Databases |
|---|---|
| 29L | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18850224 | Reaxys |
| Citations |
|---|