EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F2IN3O4 |
| Net Charge | 0 |
| Average Mass | 489.216 |
| Monoisotopic Mass | 488.99971 |
| SMILES | C[C@H](O)CONC(=O)c1oc2c(F)cncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H14F2IN3O4/c1-8(24)7-26-23-17(25)16-14(10-5-21-6-12(19)15(10)27-16)22-13-3-2-9(20)4-11(13)18/h2-6,8,22,24H,7H2,1H3,(H,23,25)/t8-/m0/s1 |
| InChIKey | ZEZHPEIEEFTILY-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| G-573 (CHEBI:83404) has role antineoplastic agent (CHEBI:35610) |
| G-573 (CHEBI:83404) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| G-573 (CHEBI:83404) is a aromatic amine (CHEBI:33860) |
| G-573 (CHEBI:83404) is a furopyridine (CHEBI:38197) |
| G-573 (CHEBI:83404) is a monocarboxylic acid amide (CHEBI:29347) |
| G-573 (CHEBI:83404) is a organofluorine compound (CHEBI:37143) |
| G-573 (CHEBI:83404) is a organoiodine compound (CHEBI:37142) |
| G-573 (CHEBI:83404) is a secondary alcohol (CHEBI:35681) |
| G-573 (CHEBI:83404) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 7-fluoro-3-[(2-fluoro-4-iodophenyl)amino]-N-[(2S)-2-hydroxypropoxy]furo[3,2-c]pyridine-2-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13101316 | Reaxys |
| Citations |
|---|