EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8340 - Portulacaxanthin I
| Formula | C14H16N2O7 |
| Net Charge | 0 |
| Average Mass | 324.289 |
| Monoisotopic Mass | 324.09575 |
| SMILES | O=C(O)C1=C/C(=C/C=[N+]2/C[C@H](O)C[C@H]2C(=O)[O-])C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C14H16N2O7/c17-8-5-11(14(22)23)16(6-8)2-1-7-3-9(12(18)19)15-10(4-7)13(20)21/h1-3,8,10-11,17H,4-6H2,(H3,18,19,20,21,22,23)/t8-,10+,11+/m1/s1 |
| InChIKey | GVARXLMKUDMZFN-MIMYLULJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Portulacaxanthin I (CHEBI:8340) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Portulacaxanthin I | KEGG COMPOUND |