EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O6 |
| Net Charge | 0 |
| Average Mass | 322.317 |
| Monoisotopic Mass | 322.11649 |
| SMILES | CC[C@@H](C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)C=C(C)C |
| InChI | InChI=1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3/t10-/m1/s1 |
| InChIKey | ZRDUSMYWDRPZRM-SNVBAGLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-binapacryl (CHEBI:83367) is a 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate (CHEBI:83366) |
| (R)-binapacryl (CHEBI:83367) is enantiomer of (S)-binapacryl (CHEBI:83371) |
| Incoming Relation(s) |
| binapacryl (CHEBI:82153) has part (R)-binapacryl (CHEBI:83367) |
| (S)-binapacryl (CHEBI:83371) is enantiomer of (R)-binapacryl (CHEBI:83367) |
| IUPAC Name |
|---|
| 2-[(2R)-butan-2-yl]-4,6-dinitrophenyl 3-methylbut-2-enoate |