EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O |
| Net Charge | 0 |
| Average Mass | 136.154 |
| Monoisotopic Mass | 136.06366 |
| SMILES | NC(=NO)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
| InChIKey | MXOQNVMDKHLYCZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzamidoxime (CHEBI:83354) has functional parent benzamide (CHEBI:28179) |
| benzamidoxime (CHEBI:83354) has role bacterial metabolite (CHEBI:76969) |
| benzamidoxime (CHEBI:83354) has role genotoxin (CHEBI:50902) |
| benzamidoxime (CHEBI:83354) has role mammalian metabolite (CHEBI:75768) |
| benzamidoxime (CHEBI:83354) is a amidoxime (CHEBI:65234) |
| IUPAC Name |
|---|
| N-hydroxybenzenecarboximidamide |
| Synonyms | Source |
|---|---|
| benzamide oxime | SUBMITTER |
| benzohydroxamamide | SUBMITTER |
| N-Hydroxybenzamidine | ChemIDplus |
| phenylhydroxamidine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| benzamidoxime | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:606795 | Reaxys |
| CAS:613-92-3 | ChemIDplus |
| Citations |
|---|