EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C23H36N2O4.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 959.188 |
| Monoisotopic Mass | 958.55145 |
| SMILES | CCCCCCCC(=O)N[C@H](CN1CCCC1)[C@H](O)c1ccc2c(c1)OCCO2.CCCCCCCC(=O)N[C@H](CN1CCCC1)[C@H](O)c1ccc2c(c1)OCCO2.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C23H36N2O4.C4H6O6/c2*1-2-3-4-5-6-9-22(26)24-19(17-25-12-7-8-13-25)23(27)18-10-11-20-21(16-18)29-15-14-28-20;5-1(3(7)8)2(6)4(9)10/h2*10-11,16,19,23,27H,2-9,12-15,17H2,1H3,(H,24,26);1-2,5-6H,(H,7,8)(H,9,10)/t2*19-,23-;1-,2-/m111/s1 |
| InChIKey | KUBARPMUNHKBIQ-VTHUDJRQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the activity of ceramide glucosyltransferase (EC 2.4.1.80). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eliglustat tartrate (CHEBI:83353) has part eliglustat(1+) (CHEBI:83355) |
| eliglustat tartrate (CHEBI:83353) has role EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor (CHEBI:50382) |
| eliglustat tartrate (CHEBI:83353) is a tartrate salt (CHEBI:50562) |
| IUPAC Names |
|---|
| bis{N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(pyrrolidin-1-yl)propan-2-yl]octanamide} (2R,3R)-2,3-dihydroxysuccinic acid |
| bis{1-[(2R,3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-2-(octanoylamino)propyl]pyrrolidinium} (2R,3R)-2,3-dihydroxysuccinate |
| Synonyms | Source |
|---|---|
| eliglustat hemitartrate | ChEBI |
| Genz-112638 | ChemIDplus |
| eliglustat L-tartrate | ChEBI |
| Brand Name | Source |
|---|---|
| Cerdelga | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09894 | KEGG DRUG |
| Eliglustat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21475296 | Reaxys |
| CAS:928659-70-5 | KEGG DRUG |
| CAS:928659-70-5 | ChemIDplus |
| Citations |
|---|