EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30MgN4O5 |
| Net Charge | -2 |
| Average Mass | 610.953 |
| Monoisotopic Mass | 610.20776 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(C)c6c7[n]5[Mg-2]34[N+]3=C(C=2)C(C)=C(CCC(=O)[O-])C3=C7[C-](C(=O)OC)C6=O)C(CC)=C1C |
| InChI | InChI=1S/C35H33N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,12-14H,1,9-11H2,2-7H3,(H3,36,37,38,39,40,41,42);/q-1;+2/p-3/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-; |
| InChIKey | SSIKFLKOTZKJAG-UAVVDGTISA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protochlorophyllide(2−) (CHEBI:83350) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| protochlorophyllide(2−) (CHEBI:83350) is a monocarboxylic acid anion (CHEBI:35757) |
| protochlorophyllide(2−) (CHEBI:83350) is conjugate base of protochlorophyllide(1−) (CHEBI:57855) |
| Incoming Relation(s) |
| protochlorophyllide(1−) (CHEBI:57855) is conjugate acid of protochlorophyllide(2−) (CHEBI:83350) |
| UniProt Name | Source |
|---|---|
| protochlorophyllide a | UniProt |