EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20ClNO5 |
| Net Charge | 0 |
| Average Mass | 365.813 |
| Monoisotopic Mass | 365.10300 |
| SMILES | COc1cc(C)c(C(=O)c2c(OC)ncc(Cl)c2C)c(OC)c1OC |
| InChI | InChI=1S/C18H20ClNO5/c1-9-7-12(22-3)16(23-4)17(24-5)13(9)15(21)14-10(2)11(19)8-20-18(14)25-6/h7-8H,1-6H3 |
| InChIKey | NMVCBWZLCXANER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyriofenone (CHEBI:83346) has role antifungal agrochemical (CHEBI:86328) |
| pyriofenone (CHEBI:83346) is a aromatic ether (CHEBI:35618) |
| pyriofenone (CHEBI:83346) is a aromatic ketone (CHEBI:76224) |
| pyriofenone (CHEBI:83346) is a aryl phenyl ketone fungicide (CHEBI:87035) |
| pyriofenone (CHEBI:83346) is a chloropyridine (CHEBI:39173) |
| IUPAC Name |
|---|
| (5-chloro-2-methoxy-4-methylpyridin-3-yl)(2,3,4-trimethoxy-6-methylphenyl)methanone |
| Synonyms | Source |
|---|---|
| pyriofénone | ChEBI |
| (5-chloro-2-methoxy-4-methyl-3-pyridinyl)(2,3,4-trimethoxy-6-methylphenyl)methanone | Alan Wood's Pesticides |
| (5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone | Alan Wood's Pesticides |
| IKF-309 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| pyriofenone | Alan Wood's Pesticides |
| 2460 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11330354 | Reaxys |
| CAS:688046-61-9 | ChemIDplus |