EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21BrO5 |
| Net Charge | 0 |
| Average Mass | 409.276 |
| Monoisotopic Mass | 408.05724 |
| SMILES | COc1cc(C)c(C(=O)c2c(OC)ccc(Br)c2C)c(OC)c1OC |
| InChI | InChI=1S/C19H21BrO5/c1-10-9-14(23-4)18(24-5)19(25-6)15(10)17(21)16-11(2)12(20)7-8-13(16)22-3/h7-9H,1-6H3 |
| InChIKey | AMSPWOYQQAWRRM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metrafenone (CHEBI:83345) has role antifungal agrochemical (CHEBI:86328) |
| metrafenone (CHEBI:83345) is a aromatic ether (CHEBI:35618) |
| metrafenone (CHEBI:83345) is a aryl phenyl ketone fungicide (CHEBI:87035) |
| metrafenone (CHEBI:83345) is a benzophenones (CHEBI:22726) |
| metrafenone (CHEBI:83345) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (3-bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methylphenyl)methanone |
| Synonyms | Source |
|---|---|
| 3'-bromo-2,3,4,6'-tetramethoxy-2',6-dimethylbenzophenone | Alan Wood's Pesticides |
| BAS 560 02F | ChemIDplus |
| métrafénone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 468 | PPDB |
| metrafenone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343406 | Reaxys |
| CAS:220899-03-6 | ChemIDplus |
| Citations |
|---|