EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17,19,21H,2-6,12,15-16,18H2,1H3,(H,22,23)/p-1/b9-7-,11-8-,13-10-,17-14+/t19-/m1/s1 |
| InChIKey | ZNHVWPKMFKADKW-ZYBDYUKJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(R)-HETE(1−) (CHEBI:83343) is a HETE anion (CHEBI:131858) |
| 12(R)-HETE(1−) (CHEBI:83343) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| 12(R)-HETE(1−) (CHEBI:83343) is a icosanoid anion (CHEBI:62937) |
| 12(R)-HETE(1−) (CHEBI:83343) is a long-chain fatty acid anion (CHEBI:57560) |
| 12(R)-HETE(1−) (CHEBI:83343) is conjugate base of 12(R)-HETE (CHEBI:34144) |
| Incoming Relation(s) |
| 12(R)-HETE (CHEBI:34144) is conjugate acid of 12(R)-HETE(1−) (CHEBI:83343) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12R,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
| Synonyms | Source |
|---|---|
| (5Z,8Z,10E,12R,14Z)-12-hydroxyeicosatetraenoate(1−) | SUBMITTER |
| (5Z,8Z,10E,12R,14Z)-12-hydroxyicosatetraenoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (12R)-hydroxy-(5Z,8Z,10E,14Z)-eicosatetraenoate | UniProt |