EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83341 - tecloftalam
| Formula | C14H5Cl6NO3 |
| Net Charge | 0 |
| Average Mass | 447.916 |
| Monoisotopic Mass | 444.84006 |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H5Cl6NO3/c15-4-2-1-3-5(8(4)16)21-13(22)6-7(14(23)24)10(18)12(20)11(19)9(6)17/h1-3H,(H,21,22)(H,23,24) |
| InChIKey | ROZUQUDEWZIBHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tecloftalam (CHEBI:83341) has role agrochemical (CHEBI:33286) |
| tecloftalam (CHEBI:83341) has role antibacterial agent (CHEBI:33282) |
| tecloftalam (CHEBI:83341) is a benzanilide fungicide (CHEBI:87018) |
| tecloftalam (CHEBI:83341) is a dicarboxylic acid monoamide (CHEBI:35735) |
| tecloftalam (CHEBI:83341) is a dichlorobenzene (CHEBI:23697) |
| tecloftalam (CHEBI:83341) is a tetrachlorobenzene (CHEBI:26888) |
| IUPAC Name |
|---|
| 2,3,4,5-tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid |
| Synonyms | Source |
|---|---|
| techlofthalam | ChemIDplus |
| 3,4,5,6-tetrachloro-N-(2,3-dichlorophenyl)phthalamic acid | ChemIDplus |
| 2',3',3,4,5,6-hexachloro phthalanilic acid | ChemIDplus |
| N-(2,3-dichlorophenyl)-3,4,5,6-tetrachlorophthalamic acid | ChemIDplus |
| 6-(((2,3-dichlorophenyl)amino)carbonyl)-2,3,4,5-tetrachlorobenzoic acid | ChemIDplus |
| 2,3,4,5-tetrachloro-6-[[(2,3-dichlorophenyl)amino]carbonyl]benzoic acid | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Shirahagen S | ChemIDplus |
| Shiragen | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| tecloftalam | Alan Wood's Pesticides |
| 1214 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13427114 | Reaxys |
| CAS:76280-91-6 | ChemIDplus |
| Citations |
|---|