EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C11H17NO3.H2O4S |
| Net Charge | 0 |
| Average Mass | 520.601 |
| Monoisotopic Mass | 520.20907 |
| SMILES | CC(C)NC[C@@H](O)c1cc(O)cc(O)c1.CC(C)NC[C@@H](O)c1cc(O)cc(O)c1.O=S(=O)(O)O |
| InChI | InChI=1S/2C11H17NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,11-15H,6H2,1-2H3;(H2,1,2,3,4)/t2*11-;/m11./s1 |
| InChIKey | MKFFGUZYVNDHIH-ZVRYYDNZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-orciprenaline sulfate (CHEBI:83337) has part (S)-orciprenaline(1+) (CHEBI:83338) |
| (S)-orciprenaline sulfate (CHEBI:83337) is a alkylammonium sulfate (CHEBI:38015) |
| (S)-orciprenaline sulfate (CHEBI:83337) is enantiomer of (R)-orciprenaline sulfate (CHEBI:83333) |
| Incoming Relation(s) |
| (R)-orciprenaline sulfate (CHEBI:83333) is enantiomer of (S)-orciprenaline sulfate (CHEBI:83337) |
| IUPAC Names |
|---|
| 5-[(1S)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol sulfate (2:1) |
| bis{N-[(2S)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]propan-2-aminium} sulfate |