EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O4 |
| Net Charge | -1 |
| Average Mass | 359.486 |
| Monoisotopic Mass | 359.22278 |
| SMILES | CC/C=C\C/C=C\CC(/C=C/C=C\C/C=C\C/C=C\CCC(=O)[O-])OO |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-12-15-18-21(26-25)19-16-13-10-8-6-7-9-11-14-17-20-22(23)24/h3-4,6-7,10-16,19,21,25H,2,5,8-9,17-18,20H2,1H3,(H,23,24)/p-1/b4-3-,7-6-,13-10-,14-11-,15-12-,19-16+ |
| InChIKey | OAGAUECBCOAGOL-BGKMTWLOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-HPDHE(1−) (CHEBI:83336) has functional parent (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate (CHEBI:77016) |
| 14-HPDHE(1−) (CHEBI:83336) is a hydroperoxydocosahexaenoate (CHEBI:131868) |
| 14-HPDHE(1−) (CHEBI:83336) is conjugate base of 14-HPDHE (CHEBI:84177) |
| Incoming Relation(s) |
| 14(S)-HPDHE(1−) (CHEBI:78048) is a 14-HPDHE(1−) (CHEBI:83336) |
| 14-HPDHE (CHEBI:84177) is conjugate acid of 14-HPDHE(1−) (CHEBI:83336) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroperoxydocosa-4,7,10,12,16,19-hexaenoate |
| Synonyms | Source |
|---|---|
| (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroperoxydocosahexaenoate(1−) | SUBMITTER |
| 14-HPD(4,7,10,12,16,19)HE(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 14-hydroperoxy-(4Z,7Z,10Z,12E,16Z,19Z)-docosahexaenoate | UniProt |