EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83335 - triazoxide
| Formula | C10H6ClN5O |
| Net Charge | 0 |
| Average Mass | 247.645 |
| Monoisotopic Mass | 247.02609 |
| SMILES | [O-][n+]1nc(-n2ccnc2)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H6ClN5O/c11-7-1-2-8-9(5-7)16(17)14-10(13-8)15-4-3-12-6-15/h1-6H |
| InChIKey | IQGKIPDJXCAMSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triazoxide (CHEBI:83335) has role antifungal agrochemical (CHEBI:86328) |
| triazoxide (CHEBI:83335) is a N-oxide (CHEBI:35580) |
| triazoxide (CHEBI:83335) is a benzotriazines (CHEBI:51361) |
| triazoxide (CHEBI:83335) is a imidazole fungicide (CHEBI:87068) |
| triazoxide (CHEBI:83335) is a imidazoles (CHEBI:24780) |
| triazoxide (CHEBI:83335) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 7-chloro-3-(1H-imidazol-1-yl)-1,2,4-benzotriazine 1-oxide |
| Synonym | Source |
|---|---|
| 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine 1-oxide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| triazoxide | PDBeChem |
| DE2802488 | Patent |
| US4239760 | Patent |
| 654 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:617803 | Reaxys |
| CAS:72459-58-6 | ChemIDplus |
| Citations |
|---|