EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O4 |
| Net Charge | -1 |
| Average Mass | 337.480 |
| Monoisotopic Mass | 337.23843 |
| SMILES | CCCCC/C=C\CC(/C=C/C=C\CCCCCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h8,10-11,13-14,17,19,23H,2-7,9,12,15-16,18H2,1H3,(H,21,22)/p-1/b11-8-,13-10-,17-14+ |
| InChIKey | CZOASFIZEHMKCK-VHBNVGGOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) is a hydroperoxy polyunsaturated fatty acid anion (CHEBI:134019) |
| 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) is a hydroperoxyicosatrienoate (CHEBI:131875) |
| 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) is a icosanoid anion (CHEBI:62937) |
| 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) is a long-chain fatty acid anion (CHEBI:57560) |
| 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) is conjugate base of 12-HPE(8,10,14)TrE (CHEBI:84174) |
| Incoming Relation(s) |
| 12(S)-HPE(8,10,14)TrE(1−) (CHEBI:78047) is a 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) |
| 12-HPE(8,10,14)TrE (CHEBI:84174) is conjugate acid of 12-HPE(8,10,14)TrE(1−) (CHEBI:83334) |
| IUPAC Name |
|---|
| (8Z,10E,14Z)-12-hydroperoxyicosa-8,10,14-trienoate |
| Synonyms | Source |
|---|---|
| 12-HPTrE(1−) | SUBMITTER |
| (8Z,10E,14Z)-12-hydroperoxyicosatrienoate(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (8Z,10E,14Z)-12-hydroperoxyeicosatrienoate | UniProt |