EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O2S |
| Net Charge | 0 |
| Average Mass | 331.441 |
| Monoisotopic Mass | 331.13545 |
| SMILES | C=CCSC(=O)n1c(N)c(-c2ccccc2C)c(=O)n1C(C)C |
| InChI | InChI=1S/C17H21N3O2S/c1-5-10-23-17(22)20-15(18)14(16(21)19(20)11(2)3)13-9-7-6-8-12(13)4/h5-9,11H,1,10,18H2,2-4H3 |
| InChIKey | UTOHZQYBSYOOGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenpyrazamine (CHEBI:83327) has role antifungal agrochemical (CHEBI:86328) |
| fenpyrazamine (CHEBI:83327) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| fenpyrazamine (CHEBI:83327) is a primary amino compound (CHEBI:50994) |
| fenpyrazamine (CHEBI:83327) is a pyrazolone (CHEBI:83328) |
| fenpyrazamine (CHEBI:83327) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-allyl 5-amino-2-isopropyl-4-(2-methylphenyl)-3-oxo-2,3-dihydro-1H-pyrazole-1-carbothioat |
| Synonyms | Source |
|---|---|
| S-2-propen-1-yl 5-amino-2,3-dihydro-2-(1-methylethyl)-4-(2-methylphenyl)-3-oxo-1H-pyrazole-1-carbothioate | ChemIDplus |
| S-allyl 5-amino-2,3-dihydro-2-isopropyl-3-oxo-4-(o-tolyl)pyrazole-1-carbothioate | ChemIDplus |
| 5-amino-2-isopropyl-3-oxo-4-o-tolyl-2,3-dihydropyrazole-1-thiocarboxylic acid S-allyl ester | ChEBI |
| Brand Name | Source |
|---|---|
| Botrycide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| fenpyrazamine | Alan Wood's Pesticides |
| 2010 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12610944 | Reaxys |
| CAS:473798-59-3 | ChemIDplus |