EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16FN6O6P |
| Net Charge | 0 |
| Average Mass | 450.323 |
| Monoisotopic Mass | 450.08530 |
| SMILES | Cn1nnc(-c2ccc(-c3ccc(N4C[C@H](COP(=O)(O)O)OC4=O)cc3F)cn2)n1 |
| InChI | InChI=1S/C17H16FN6O6P/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(30-17(24)25)9-29-31(26,27)28/h2-7,12H,8-9H2,1H3,(H2,26,27,28)/t12-/m1/s1 |
| InChIKey | QCGUSIANLFXSGE-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tedizolid phosphate (CHEBI:83326) has role antimicrobial agent (CHEBI:33281) |
| tedizolid phosphate (CHEBI:83326) has role prodrug (CHEBI:50266) |
| tedizolid phosphate (CHEBI:83326) has role protein synthesis inhibitor (CHEBI:48001) |
| tedizolid phosphate (CHEBI:83326) is a carbamate ester (CHEBI:23003) |
| tedizolid phosphate (CHEBI:83326) is a organofluorine compound (CHEBI:37143) |
| tedizolid phosphate (CHEBI:83326) is a oxazolidinone (CHEBI:55374) |
| tedizolid phosphate (CHEBI:83326) is a phosphate monoester (CHEBI:7794) |
| tedizolid phosphate (CHEBI:83326) is a pyridines (CHEBI:26421) |
| tedizolid phosphate (CHEBI:83326) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| [(5R)-3-{3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl]phenyl}-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| Tedizolid phosphate | KEGG DRUG |
| Torezolid phosphate | ChemIDplus |
| TR-701 | ChEBI |
| TR-701 FA | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sivextro | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12031391 | Reaxys |
| CAS:856867-55-5 | KEGG DRUG |
| CAS:856867-55-5 | ChemIDplus |