EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO |
| Net Charge | 0 |
| Average Mass | 283.500 |
| Monoisotopic Mass | 283.28751 |
| SMILES | CCCCCCCCCCCCN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C18H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-19-15-17(2)20-18(3)16-19/h17-18H,4-16H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | SBUKOHLFHYSZNG-ROUUACIJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,6S)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83300) is a 4-dodecyl-2,6-dimethylmorpholine (CHEBI:83297) |
| (2S,6S)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83300) is enantiomer of (2R,6R)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83301) |
| Incoming Relation(s) |
| rac-trans-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83302) has part (2S,6S)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83300) |
| (2R,6R)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83301) is enantiomer of (2S,6S)-4-dodecyl-2,6-dimethylmorpholine (CHEBI:83300) |
| IUPAC Name |
|---|
| (S,S)-4-dodecyl-2,6-dimethylmorpholine |
| Synonyms | Source |
|---|---|
| (2S,trans)-4-dodecyl-2,6-dimethylmorpholine | ChEBI |
| (S,S)-4-dodecyl-2,6-dimethylmorpholine | ChEBI |