EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31N |
| Net Charge | 0 |
| Average Mass | 273.464 |
| Monoisotopic Mass | 273.24565 |
| SMILES | C[C@@H](Cc1ccc(C(C)(C)C)cc1)CN1CCCCC1 |
| InChI | InChI=1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | MGNFYQILYYYUBS-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-fenpropidin (CHEBI:83294) is a 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine (CHEBI:83291) |
| (S)-fenpropidin (CHEBI:83294) is enantiomer of (R)-fenpropidin (CHEBI:83293) |
| Incoming Relation(s) |
| fenpropidin (CHEBI:81917) has part (S)-fenpropidin (CHEBI:83294) |
| (R)-fenpropidin (CHEBI:83293) is enantiomer of (S)-fenpropidin (CHEBI:83294) |
| IUPAC Name |
|---|
| 1-[(2S)-3-(4-tert-butylphenyl)-2-methylpropyl]piperidine |