EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl2O2 |
| Net Charge | -1 |
| Average Mass | 190.005 |
| Monoisotopic Mass | 188.95156 |
| SMILES | O=C([O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11)/p-1 |
| InChIKey | VPHHJAOJUJHJKD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dichlorobenzoate (CHEBI:83287) is a chlorobenzoate (CHEBI:23133) |
| 3,4-dichlorobenzoate (CHEBI:83287) is conjugate base of 3,4-dichlorobenzoic acid (CHEBI:49401) |
| Incoming Relation(s) |
| 3,4-dichlorobenzoic acid (CHEBI:49401) is conjugate acid of 3,4-dichlorobenzoate (CHEBI:83287) |
| IUPAC Name |
|---|
| 3,4-dichlorobenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3665338 | Reaxys |