EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 330.255 |
| Monoisotopic Mass | 329.09493 |
| SMILES | C[C@@H]1CCCCN1CCCOC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-12-5-2-3-8-19(12)9-4-10-21-16(20)13-6-7-14(17)15(18)11-13/h6-7,11-12H,2-5,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | BZGLBXYQOMFXAU-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-piperalin (CHEBI:83285) is a 3-(2-methylpiperidin-1-yl)propyl 3,4-dichlorobenzoate (CHEBI:83284) |
| (R)-piperalin (CHEBI:83285) is enantiomer of (S)-piperalin (CHEBI:83286) |
| Incoming Relation(s) |
| piperalin (CHEBI:83283) has part (R)-piperalin (CHEBI:83285) |
| (S)-piperalin (CHEBI:83286) is enantiomer of (R)-piperalin (CHEBI:83285) |
| IUPAC Name |
|---|
| 3-[(2R)-2-methylpiperidin-1-yl]propyl 3,4-dichlorobenzoate |