EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H62FeN4O6 |
| Net Charge | +1 |
| Average Mass | 858.902 |
| Monoisotopic Mass | 858.40132 |
| SMILES | [H]C(=O)C1=C(CCC(=O)O)C2=[N]3C1=Cc1c(C)c([C@@H](O)CCCC(C)CCCC(C)CCCC(C)C)c4[n]1[Fe+]31[N]3=C(C=c5c(C)c(CCC(=O)O)c([n]51)=C2)C(C=C)=C(C)C3=C4 |
| InChI | InChI=1S/C49H64N4O6.Fe/c1-9-34-31(6)39-25-45-49(46(55)18-12-17-30(5)16-11-15-29(4)14-10-13-28(2)3)33(8)40(52-45)24-44-37(27-54)36(20-22-48(58)59)43(53-44)26-42-35(19-21-47(56)57)32(7)38(51-42)23-41(34)50-39;/h9,23-30,46,55H,1,10-22H2,2-8H3,(H4,50,51,52,53,54,56,57,58,59);/q;+3/p-2/b38-23-,39-25-,40-24-,41-23-,42-26-,43-26-,44-24-,45-25-;/t29?,30?,46-;/m0./s1 |
| InChIKey | JDCCRDMXPNAUND-PPHJLLIRSA-L |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferriheme a3 (CHEBI:83281) is a ferriheme (CHEBI:38574) |
| ferriheme a3 (CHEBI:83281) is a heme a (CHEBI:24479) |
| ferriheme a3 (CHEBI:83281) is conjugate acid of ferriheme a3(1−) (CHEBI:83282) |
| Incoming Relation(s) |
| ferriheme a3(1−) (CHEBI:83282) is conjugate base of ferriheme a3 (CHEBI:83281) |
| IUPAC Name |
|---|
| {3,3'-[7-ethenyl-17-formyl-12-[(1S)-1-hydroxy-5,9,13-trimethyltetradecyl]-3,8,13-trimethylporphyrin-2,18-diyl-κ4N21,N22,N23,N24]dipropanoato(2−)}iron(1+) |
| Citations |
|---|