EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12INO2 |
| Net Charge | 0 |
| Average Mass | 281.093 |
| Monoisotopic Mass | 280.99128 |
| SMILES | CCCCNC(=O)OCC#CI |
| InChI | InChI=1S/C8H12INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h2-3,6-7H2,1H3,(H,10,11) |
| InChIKey | WYVVKGNFXHOCQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) has role antifungal agrochemical (CHEBI:86328) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) has role environmental contaminant (CHEBI:78298) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) has role xenobiotic (CHEBI:35703) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) is a acetylenic compound (CHEBI:73474) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) is a carbamate ester (CHEBI:23003) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) is a carbamate fungicide (CHEBI:87061) |
| 3-iodoprop-2-yn-1-yl butylcarbamate (CHEBI:83279) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 3-iodoprop-2-yn-1-yl butylcarbamate |
| Synonyms | Source |
|---|---|
| 3-iodo-2-propyn-1-yl N-butylcarbamate | Alan Wood's Pesticides |
| 3-iodo-2-propynyl butylcarbamate | ChemIDplus |
| 3-iodoprop-2-ynyl butylcarbamate | Alan Wood's Pesticides |
| butyl-3-iodo-2-propynylcarbamate | ChemIDplus |
| iodocarb | ChemIDplus |
| iodocarbe | ChEBI |
| Brand Names | Source |
|---|---|
| Troysan KK-108A | ChemIDplus |
| Troysan polyphase anti-mildew | ChemIDplus |
| Woodlife | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| iodocarb | Alan Wood's Pesticides |
| Iodopropynyl_butylcarbamate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:55406-53-6 | ChemIDplus |
| CAS:55406-53-6 | Alan Wood's Pesticides |
| Citations |
|---|