EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O8 |
| Net Charge | 0 |
| Average Mass | 378.377 |
| Monoisotopic Mass | 378.13147 |
| SMILES | COc1cc(O)c2c(c1)[C@H]1O[C@@H]1C[C@H](O)[C@H](O)C(=O)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H22O8/c1-9-4-3-5-12(20)17(23)14(22)8-15-18(27-15)11-6-10(25-2)7-13(21)16(11)19(24)26-9/h3,5-7,9,14-15,17-18,21-23H,4,8H2,1-2H3/b5-3-/t9-,14-,15+,17+,18+/m0/s1 |
| InChIKey | SSNQAUBBJYCSMY-KNTMUCJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypomyces subiculosus (ncbitaxon:193393) | - | PubMed (20118535) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypothemycin (CHEBI:83275) has role antifungal agent (CHEBI:35718) |
| hypothemycin (CHEBI:83275) has role antineoplastic agent (CHEBI:35610) |
| hypothemycin (CHEBI:83275) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| hypothemycin (CHEBI:83275) has role fungal metabolite (CHEBI:76946) |
| hypothemycin (CHEBI:83275) is a aromatic ether (CHEBI:35618) |
| hypothemycin (CHEBI:83275) is a diol (CHEBI:23824) |
| hypothemycin (CHEBI:83275) is a enone (CHEBI:51689) |
| hypothemycin (CHEBI:83275) is a epoxide (CHEBI:32955) |
| hypothemycin (CHEBI:83275) is a macrolide (CHEBI:25106) |
| hypothemycin (CHEBI:83275) is a phenols (CHEBI:33853) |
| hypothemycin (CHEBI:83275) is a polyketide (CHEBI:26188) |
| hypothemycin (CHEBI:83275) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1aR,8S,10Z,13S,14S,15aR)-5,13,14-trihydroxy-3-methoxy-8-methyl-8,9,13,14,15,15a-hexahydro-6H-oxireno[k][2]benzoxacyclotetradecine-6,12(1aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6160688 | Reaxys |
| Citations |
|---|