EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O8 |
| Net Charge | 0 |
| Average Mass | 378.377 |
| Monoisotopic Mass | 378.13147 |
| SMILES | COc1cc(O)c2c(c1)[C@H]1O[C@@H]1C[C@H](O)[C@H](O)C(=O)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H22O8/c1-9-4-3-5-12(20)17(23)14(22)8-15-18(27-15)11-6-10(25-2)7-13(21)16(11)19(24)26-9/h3,5-7,9,14-15,17-18,21-23H,4,8H2,1-2H3/b5-3-/t9-,14-,15+,17+,18+/m0/s1 |
| InChIKey | SSNQAUBBJYCSMY-KNTMUCJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypomyces subiculosus (ncbitaxon:193393) | - | PubMed (20118535) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypothemycin (CHEBI:83275) has role antifungal agent (CHEBI:35718) |
| hypothemycin (CHEBI:83275) has role antineoplastic agent (CHEBI:35610) |
| hypothemycin (CHEBI:83275) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| hypothemycin (CHEBI:83275) has role fungal metabolite (CHEBI:76946) |
| hypothemycin (CHEBI:83275) is a aromatic ether (CHEBI:35618) |
| hypothemycin (CHEBI:83275) is a diol (CHEBI:23824) |
| hypothemycin (CHEBI:83275) is a enone (CHEBI:51689) |
| hypothemycin (CHEBI:83275) is a epoxide (CHEBI:32955) |
| hypothemycin (CHEBI:83275) is a macrolide (CHEBI:25106) |
| hypothemycin (CHEBI:83275) is a phenols (CHEBI:33853) |
| hypothemycin (CHEBI:83275) is a polyketide (CHEBI:26188) |
| hypothemycin (CHEBI:83275) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1aR,8S,10Z,13S,14S,15aR)-5,13,14-trihydroxy-3-methoxy-8-methyl-8,9,13,14,15,15a-hexahydro-6H-oxireno[k][2]benzoxacyclotetradecine-6,12(1aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6160688 | Reaxys |
| Citations |
|---|