EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13ClF3N3O4S3 |
| Net Charge | 0 |
| Average Mass | 439.890 |
| Monoisotopic Mass | 438.97088 |
| SMILES | CN1C(CSCC(F)(F)F)Nc2cc(Cl)c(S(N)(=O)=O)cc2S1(=O)=O |
| InChI | InChI=1S/C11H13ClF3N3O4S3/c1-18-10(4-23-5-11(13,14)15)17-7-2-6(12)8(24(16,19)20)3-9(7)25(18,21)22/h2-3,10,17H,4-5H2,1H3,(H2,16,19,20) |
| InChIKey | CYLWJCABXYDINA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polythiazide (CHEBI:8327) has role cardiovascular drug (CHEBI:35554) |
| Polythiazide (CHEBI:8327) is a benzothiadiazine (CHEBI:50265) |
| INN | Source |
|---|---|
| politiazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| drenusil | DrugCentral |
| nephril | DrugCentral |
| NSC-108161 | ChEMBL |
| P-2525 | ChEMBL |
| Polythiazide | KEGG COMPOUND |
| renese | DrugCentral |
| Brand Names | Source |
|---|---|
| Polythiazide component of minizide | ChEMBL |
| Polythiazide component of renese-r | ChEMBL |
| UniProt Name | Source |
|---|---|
| polythiazide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2228 | DrugCentral |
| C07766 | KEGG COMPOUND |
| D00657 | KEGG DRUG |
| HMDB0015419 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:346-18-9 | KEGG COMPOUND |
| Citations |
|---|