EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C65H103N13O21 |
| Net Charge | 0 |
| Average Mass | 1402.609 |
| Monoisotopic Mass | 1401.73915 |
| SMILES | CC[C@@H](C)/C=C(C)/C=C\[C@@H](O)[C@](C)(O)C(=O)NCC(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H]1C(=O)N[C@H](COC)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@H]([C@H](OC)c2ccc(O)cc2)C(=O)N2CCCC[C@H]2C(=O)O[C@@H]1C(C)C)[C@@H](C)[C@@H](C)C(N)=O)[C@H](C)N)[C@@H](C)O |
| InChI | InChI=1S/C65H103N13O21/c1-15-31(4)26-32(5)19-24-43(82)65(12,96)64(95)69-28-45(84)72-48(37(10)79)59(90)74-47(35(8)66)58(89)73-46(33(6)34(7)54(67)85)57(88)76-50-52(30(2)3)99-63(94)42-18-16-17-25-78(42)62(93)51(53(98-14)39-20-22-40(81)23-21-39)77-60(91)49(38(11)80)75-55(86)36(9)70-44(83)27-68-56(87)41(29-97-13)71-61(50)92/h19-24,26,30-31,33-38,41-43,46-53,79-82,96H,15-18,25,27-29,66H2,1-14H3,(H2,67,85)(H,68,87)(H,69,95)(H,70,83)(H,71,92)(H,72,84)(H,73,89)(H,74,90)(H,75,86)(H,76,88)(H,77,91)/b24-19-,32-26+/t31-,33+,34-,35+,36+,37-,38-,41-,42+,43-,46+,47+,48-,49+,50-,51-,52-,53-,65+/m1/s1 |
| InChIKey | HQVFHDUBRNXXHV-LZHJWXOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Theonella mirabilis (ncbitaxon:1336892) | - | PubMed (18318032) | |
| Theonella swinhoei (ncbitaxon:37505) | - | PubMed (18318032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papuamide B (CHEBI:83265) has role anti-HIV-1 agent (CHEBI:64947) |
| papuamide B (CHEBI:83265) has role antineoplastic agent (CHEBI:35610) |
| papuamide B (CHEBI:83265) has role marine metabolite (CHEBI:76507) |
| papuamide B (CHEBI:83265) is a cyclodepsipeptide (CHEBI:35213) |
| papuamide B (CHEBI:83265) is a olefinic compound (CHEBI:78840) |
| papuamide B (CHEBI:83265) is a secondary alcohol (CHEBI:35681) |
| papuamide B (CHEBI:83265) is a tertiary alcohol (CHEBI:26878) |
| Citations |
|---|