EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83261 - pyribencarb
| Formula | C18H20ClN3O3 |
| Net Charge | 0 |
| Average Mass | 361.829 |
| Monoisotopic Mass | 361.11932 |
| SMILES | COC(=O)NCc1cc(/C(C)=N/OCc2cccc(C)n2)ccc1Cl |
| InChI | InChI=1S/C18H20ClN3O3/c1-12-5-4-6-16(21-12)11-25-22-13(2)14-7-8-17(19)15(9-14)10-20-18(23)24-3/h4-9H,10-11H2,1-3H3,(H,20,23)/b22-13+ |
| InChIKey | CRFYLQMIDWBKRT-LPYMAVHISA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyribencarb (CHEBI:83261) has role antifungal agrochemical (CHEBI:86328) |
| pyribencarb (CHEBI:83261) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| pyribencarb (CHEBI:83261) is a carbamate fungicide (CHEBI:87061) |
| pyribencarb (CHEBI:83261) is a methyl (2-chloro-5-{N-[(6-methylpyridin-2-yl)methoxy]ethanimidoyl}benzyl)carbamate (CHEBI:142982) |
| IUPAC Name |
|---|
| methyl (2-chloro-5-{(1E)-N-[(6-methylpyridin-2-yl)methoxy]ethanimidoyl}benzyl)carbamate |
| Synonyms | Source |
|---|---|
| methyl N-[[2-chloro-5-[(1E)-1-[[(6-methyl-2-pyridinyl)methoxy]imino]ethyl]phenyl]methyl]carbamate | Alan Wood's Pesticides |
| methyl {2-chloro-5-[(1E)-1-(6-methyl-2-pyridylmethoxyimino)ethyl]benzyl}carbamate | Alan Wood's Pesticides |
| (E)-pyribencarb | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| pyribencarb | Alan Wood's Pesticides |
| NZ593632 | Patent |
| 3072 | PPDB |
| C22042 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23250906 | Reaxys |
| CAS:799247-52-2 | ChemIDplus |
| Citations |
|---|