EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3OS |
| Net Charge | 0 |
| Average Mass | 311.410 |
| Monoisotopic Mass | 311.10923 |
| SMILES | CSC1=N[C@@](C)(c2ccccc2)C(=O)N1Nc1ccccc1 |
| InChI | InChI=1S/C17H17N3OS/c1-17(13-9-5-3-6-10-13)15(21)20(16(18-17)22-2)19-14-11-7-4-8-12-14/h3-12,19H,1-2H3/t17-/m0/s1 |
| InChIKey | LMVPQMGRYSRMIW-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenamidone (CHEBI:83258) has role antifungal agrochemical (CHEBI:86328) |
| fenamidone (CHEBI:83258) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| fenamidone (CHEBI:83258) has role quinone outside inhibitor (CHEBI:141153) |
| fenamidone (CHEBI:83258) is a carbohydrazide (CHEBI:35363) |
| fenamidone (CHEBI:83258) is a imidazole fungicide (CHEBI:87068) |
| fenamidone (CHEBI:83258) is a imidazolone (CHEBI:20432) |
| fenamidone (CHEBI:83258) is a organic sulfide (CHEBI:16385) |
| IUPAC Name |
|---|
| (5S)-3-anilino-5-methyl-2-(methylsulfanyl)-5-phenyl-3,5-dihydro-4H-imidazol-4-one |
| Synonyms | Source |
|---|---|
| 1-Anilino-4-methyl-2-methylthio-4-phenylimidazolin-5-one | ChemIDplus |
| (5S)-3,5-dihydro-5-methyl-2-(methylthio)-5-phenyl-3-(phenylamino)-4H-imidazol-4-one | ChemIDplus |
| (S)-1-anilino-4-methyl-2-methylthio-4-phenylimidazolin-5-one | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| fenamidone | Alan Wood's Pesticides |
| Fenamidone | Wikipedia |
| US2010029776 | Patent |
| 289 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11336737 | Reaxys |
| CAS:161326-34-7 | ChemIDplus |
| CAS:161326-34-7 | NIST Chemistry WebBook |
| Citations |
|---|