EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O12P2 |
| Net Charge | -4 |
| Average Mass | 336.082 |
| Monoisotopic Mass | 335.96694 |
| SMILES | O=P([O-])([O-])O[C@@H]1[C@H](O)[C@H](OP(=O)([O-])[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-1-2(8)5(17-19(11,12)13)4(10)6(3(1)9)18-20(14,15)16/h1-10H,(H2,11,12,13)(H2,14,15,16)/p-4/t1-,2-,3+,4+,5+,6- |
| InChIKey | PUVHMWJJTITUGO-FICORBCRSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,3-biphosphate(4−) (CHEBI:83242) is a inositol phosphate oxoanion (CHEBI:76301) |
| 1D-myo-inositol 1,3-biphosphate(4−) (CHEBI:83242) is conjugate base of myo-inositol 1,3-bisphosphate (CHEBI:18225) |
| Incoming Relation(s) |
| myo-inositol 1,3-bisphosphate (CHEBI:18225) is conjugate acid of 1D-myo-inositol 1,3-biphosphate(4−) (CHEBI:83242) |
| UniProt Name | Source |
|---|---|
| 1D-myo-inositol 1,3-bisphosphate | UniProt |