EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21Cl2N3O3 |
| Net Charge | 0 |
| Average Mass | 434.323 |
| Monoisotopic Mass | 433.09600 |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1CO/N=C(C)/C=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-14(11-12-17-18(22)9-6-10-19(17)23)25-29-13-15-7-4-5-8-16(15)20(26-28-3)21(27)24-2/h4-12H,13H2,1-3H3,(H,24,27)/b12-11+,25-14+,26-20+ |
| InChIKey | RBWGTZRSEOIHFD-UHUFKFKFSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenaminstrobin (CHEBI:83220) has role antifungal agrochemical (CHEBI:86328) |
| fenaminstrobin (CHEBI:83220) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| fenaminstrobin (CHEBI:83220) is a amide fungicide (CHEBI:60600) |
| fenaminstrobin (CHEBI:83220) is a dichlorobenzene (CHEBI:23697) |
| fenaminstrobin (CHEBI:83220) is a methoxyiminoacetamide strobilurin antifungal agent (CHEBI:86487) |
| fenaminstrobin (CHEBI:83220) is a monocarboxylic acid amide (CHEBI:29347) |
| fenaminstrobin (CHEBI:83220) is a olefinic compound (CHEBI:78840) |
| fenaminstrobin (CHEBI:83220) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| (2E)-2-{2-[({(E)-[(3E)-4-(2,6-dichlorophenyl)but-3-en-2-ylidene]amino}oxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide |
| Synonyms | Source |
|---|---|
| (2E)-2-{2-[({[(2E,3E)-4-(2,6-dichlorophenyl)but-3-en-2-ylidene]amino}oxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide | Alan Wood's Pesticides |
| (alphaE)-2-((((E)-((2E)-3-(2,6-dichlorophenyl)-1-methyl-2-propen-1-ylidene)amino)oxy)methyl)-alpha-(methoxyimino)-N-methylbenzeneacetamide | ChemIDplus |
| Fenaminstrobine | ChemIDplus |
| SYP 1620 | ChemIDplus |
| Xiwojunan | ChemIDplus |
| (αE)-2-[[[(E)-[(2E)-3-(2,6-dichlorophenyl)-1-methyl-2-propen-1-ylidene]amino]oxy]methyl]-α-(methoxyimino)-N-methylbenzeneacetamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 2614 | PPDB |
| CN101836631 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25678113 | Reaxys |
| CAS:366815-39-6 | ChemIDplus |
| Citations |
|---|