EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO3 |
| Net Charge | 0 |
| Average Mass | 313.397 |
| Monoisotopic Mass | 313.16779 |
| SMILES | CNC(=O)[C@H](OC)c1ccccc1COc1cc(C)ccc1C |
| InChI | InChI=1S/C19H23NO3/c1-13-9-10-14(2)17(11-13)23-12-15-7-5-6-8-16(15)18(22-4)19(21)20-3/h5-11,18H,12H2,1-4H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | PDPWCKVFIFAQIQ-GOSISDBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-mandestrobin (CHEBI:83209) is a 2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-methoxy-N-methylacetamide (CHEBI:83208) |
| (R)-mandestrobin (CHEBI:83209) is enantiomer of (S)-mandestrobin (CHEBI:83210) |
| Incoming Relation(s) |
| mandestrobin (CHEBI:83205) has part (R)-mandestrobin (CHEBI:83209) |
| (S)-mandestrobin (CHEBI:83210) is enantiomer of (R)-mandestrobin (CHEBI:83209) |
| IUPAC Name |
|---|
| (2R)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-methoxy-N-methylacetamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20787700 | Reaxys |