EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H60N12O18S |
| Net Charge | 0 |
| Average Mass | 993.020 |
| Monoisotopic Mass | 992.38692 |
| SMILES | [H][C@]1([C@@H](O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCCN(O)C(C)=O)NC(=O)[C@H](CCCN(O)C(C)=O)NC(=O)[C@@H](N)CCCN(O)C(C)=O)C(=O)O)S[C@@]([H])(n2ccc(=NC(N)=O)n(C)c2=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C37H60N12O18S/c1-17(51)47(65)12-5-8-20(38)30(57)40-21(9-6-13-48(66)18(2)52)31(58)41-22(10-7-14-49(67)19(3)53)32(59)42-23(16-50)33(60)44-25(35(61)62)26(54)29-27(55)28(56)34(68-29)46-15-11-24(43-36(39)63)45(4)37(46)64/h11,15,20-23,25-29,34,50,54-56,65-67H,5-10,12-14,16,38H2,1-4H3,(H2,39,63)(H,40,57)(H,41,58)(H,42,59)(H,44,60)(H,61,62)/t20-,21-,22-,23-,25+,26-,27+,28+,29+,34+/m0/s1 |
| InChIKey | YXNKTOYTHKJHIU-RREKCFDTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrialbomycin δ2 (CHEBI:83200) is a desferrialbomycins (CHEBI:83198) |
| desferrialbomycin δ2 (CHEBI:83200) is a ureas (CHEBI:47857) |
| desferrialbomycin δ2 (CHEBI:83200) is conjugate acid of desferrialbomycin δ2(3−) (CHEBI:83214) |
| Incoming Relation(s) |
| desferrialbomycin δ2(3−) (CHEBI:83214) is conjugate base of desferrialbomycin δ2 (CHEBI:83200) |
| IUPAC Name |
|---|
| N5-acetyl-N5-hydroxy-L-ornithyl-N5-acetyl-N5-hydroxy-L-ornithyl-N5-acetyl-N5-hydroxy-L-ornithyl-L-seryl-(3S)-3-{(2R,3R,4R,5R)-5-[4-(carbamoylimino)-3-methyl-2-oxo-3,4-dihydropyrimidin-1(2H)-yl]-3,4-dihydroxytetrahydrothiophen-2-yl}-D-serine |
| Synonyms | Source |
|---|---|
| desferrialbomycin δ(2) | ChEBI |
| deferrialbomycin δ2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5236850 | Reaxys |