EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16F3NO4 |
| Net Charge | 0 |
| Average Mass | 367.323 |
| Monoisotopic Mass | 367.10314 |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H16F3NO4/c1-24-11-14(17(23)25-2)13-7-4-3-6-12(13)10-26-16-9-5-8-15(22-16)18(19,20)21/h3-9,11H,10H2,1-2H3/b14-11+ |
| InChIKey | IBSNKSODLGJUMQ-SDNWHVSQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picoxystrobin (CHEBI:83197) has role antifungal agrochemical (CHEBI:86328) |
| picoxystrobin (CHEBI:83197) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| picoxystrobin (CHEBI:83197) is a aromatic ether (CHEBI:35618) |
| picoxystrobin (CHEBI:83197) is a enoate ester (CHEBI:51702) |
| picoxystrobin (CHEBI:83197) is a enol ether (CHEBI:47985) |
| picoxystrobin (CHEBI:83197) is a methoxyacrylate strobilurin antifungal agent (CHEBI:86484) |
| picoxystrobin (CHEBI:83197) is a organofluorine compound (CHEBI:37143) |
| picoxystrobin (CHEBI:83197) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| methyl (2E)-3-methoxy-2-[2-({[6-(trifluoromethyl)pyridin-2-yl]oxy}methyl)phenyl]prop-2-enoate |
| Synonyms | Source |
|---|---|
| methyl (2E)-3-methoxy-2-{2-[6-(trifluoromethyl)-2-pyridyloxymethyl]phenyl}acrylate | Alan Wood's Pesticides |
| methyl (αE)-α-(methoxymethylene)-2-[[[6-(trifluoromethyl)-2-pyridinyl]oxy]methyl]benzeneacetate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| picoxystrobin | Alan Wood's Pesticides |
| WO2012020774 | Patent |
| 527 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322204 | Reaxys |
| CAS:117428-22-5 | ChemIDplus |
| Citations |
|---|