EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F2N3O |
| Net Charge | 0 |
| Average Mass | 331.366 |
| Monoisotopic Mass | 331.14962 |
| SMILES | Cn1cc(C(=O)Nc2ccccc2[C@H]2C[C@@H]2C2CC2)c(C(F)F)n1 |
| InChI | InChI=1S/C18H19F2N3O/c1-23-9-14(16(22-23)17(19)20)18(24)21-15-5-3-2-4-11(15)13-8-12(13)10-6-7-10/h2-5,9-10,12-13,17H,6-8H2,1H3,(H,21,24)/t12-,13-/m1/s1 |
| InChIKey | XQJQCBDIXRIYRP-CHWSQXEVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-(1R,2S)-sedaxane (CHEBI:83179) is a N-{2-[1,1'-bi(cyclopropyl)-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1pyrazole-4-carboxamide (CHEBI:83174) |
| trans-(1R,2S)-sedaxane (CHEBI:83179) is enantiomer of trans-(1S,2R)-sedaxane (CHEBI:83178) |
| Incoming Relation(s) |
| sedaxane (CHEBI:83173) has part trans-(1R,2S)-sedaxane (CHEBI:83179) |
| trans-(1S,2R)-sedaxane (CHEBI:83178) is enantiomer of trans-(1R,2S)-sedaxane (CHEBI:83179) |
| IUPAC Name |
|---|
| N-{2-[(1R,2S)-1,1'-bi(cyclopropyl)-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21104310 | Reaxys |