EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O3S |
| Net Charge | 0 |
| Average Mass | 234.321 |
| Monoisotopic Mass | 234.10381 |
| SMILES | CCSCC[C@H](NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S/c1-3-15-5-4-7(9(13)14)11-8(12)6(2)10/h6-7H,3-5,10H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | AISCZALZKQQQKX-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Eth (CHEBI:83158) has role poison (CHEBI:64909) |
| Ala-Eth (CHEBI:83158) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-alanyl-S-ethyl-L-homocysteine |
| Synonyms | Source |
|---|---|
| L-Ala-L-Eth | ChEBI |
| alanylethionine | ChEBI |
| Ala-Eth dipeptide | ChEBI |
| L-alanyl-L-ethionine | ChEBI |