EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N4Pt |
| Net Charge | +2 |
| Average Mass | 517.534 |
| Monoisotopic Mass | 517.17944 |
| SMILES | Cc1c(C)c2ccc[n+]3c2c2c1ccc[n+]2[Pt-2]31[NH2+][C@H]2CCCC[C@@H]2[NH2+]1 |
| InChI | InChI=1S/C14H12N2.C6H14N2.Pt/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;7-5-3-1-2-4-6(5)8;/h3-8H,1-2H3;5-6H,1-4,7-8H2;/q;;+2/t;5-,6-;/m.0./s1 |
| InChIKey | IMHDLNUUBBHKNH-DQMILIFFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5,6-dimethyl-1,10-phenanthroline)(1S,2S-diaminocyclohexane)platinum(II)(2+) (CHEBI:83153) has role antineoplastic agent (CHEBI:35610) |
| (5,6-dimethyl-1,10-phenanthroline)(1S,2S-diaminocyclohexane)platinum(II)(2+) (CHEBI:83153) is a organic cation (CHEBI:25697) |
| (5,6-dimethyl-1,10-phenanthroline)(1S,2S-diaminocyclohexane)platinum(II)(2+) (CHEBI:83153) is a platinum coordination entity (CHEBI:33862) |
| IUPAC Name |
|---|
| [(1S,2S)-cyclohexane-1,2-diamine-κ2N,N'](5,6-dimethyl-1,10-phenanthroline-κ2N1,N10)platinum(2+) |
| Synonym | Source |
|---|---|
| 56MESS | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18047867 | Reaxys |
| Citations |
|---|