EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20F3N3OS |
| Net Charge | 0 |
| Average Mass | 359.417 |
| Monoisotopic Mass | 359.12792 |
| SMILES | CC(C)C[C@H](C)c1sccc1NC(=O)c1cn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3N3OS/c1-9(2)7-10(3)13-12(5-6-24-13)20-15(23)11-8-22(4)21-14(11)16(17,18)19/h5-6,8-10H,7H2,1-4H3,(H,20,23)/t10-/m0/s1 |
| InChIKey | PFFIDZXUXFLSSR-JTQLQIEISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-penthiopyrad (CHEBI:83140) is a 1-methyl-N-[2-(4-methylpentan-2-yl)-3-thienyl]-3-(trifluoromethyl)pyrazole-4-carboxamide (CHEBI:83138) |
| (S)-penthiopyrad (CHEBI:83140) is enantiomer of (R)-penthiopyrad (CHEBI:83141) |
| Incoming Relation(s) |
| penthiopyrad (CHEBI:81777) has part (S)-penthiopyrad (CHEBI:83140) |
| (R)-penthiopyrad (CHEBI:83141) is enantiomer of (S)-penthiopyrad (CHEBI:83140) |
| IUPAC Name |
|---|
| 1-methyl-N-{2-[(2S)-4-methylpentan-2-yl]-3-thienyl}-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12376368 | Reaxys |