EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O3 |
| Net Charge | 0 |
| Average Mass | 412.614 |
| Monoisotopic Mass | 412.29775 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC[C@H](C)C(=O)O)[C@@]1(C)C=CC(=O)C2 |
| InChI | InChI=1S/C27H40O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h9,12,14,17-19,22-24H,5-8,10-11,13,15-16H2,1-4H3,(H,29,30)/t17-,18+,19+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | ZDKITBVZRSMXSV-OBRBSRNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (24411940) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ1,Δ7-dafachronic acid (CHEBI:83137) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| Δ1,Δ7-dafachronic acid (CHEBI:83137) is a 3-oxo Δ7-steroid (CHEBI:71598) |
| Δ1,Δ7-dafachronic acid (CHEBI:83137) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| Δ1,Δ7-dafachronic acid (CHEBI:83137) is a dafachronic acids (CHEBI:78698) |
| IUPAC Name |
|---|
| (25S)-3-oxo-5α-cholesta-1,7-dien-26-oic acid |
| Synonyms | Source |
|---|---|
| (5α,25S)-3-oxocholesta-1,7-dien-26-oic acid | IUPAC |
| dafa#3 | ChEBI |
| (+)-(5α,25S)-3-oxocholesta-1,7-dien-26-oic acid | ChEBI |
| dafa#1 | ChEBI |
| (+)-(25S)-3-keto-cholest-1,7-dien-26-oic acid | ChEBI |
| (25S)-Δ(1,7)-dafachronic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22680175 | Reaxys |
| CAS:1377666-88-0 | SMID |
| Citations |
|---|