EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24FN3O |
| Net Charge | 0 |
| Average Mass | 317.408 |
| Monoisotopic Mass | 317.19034 |
| SMILES | Cc1nn(C)c(F)c1C(=O)Nc1ccccc1[C@H](C)CC(C)C |
| InChI | InChI=1S/C18H24FN3O/c1-11(2)10-12(3)14-8-6-7-9-15(14)20-18(23)16-13(4)21-22(5)17(16)19/h6-9,11-12H,10H2,1-5H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | GOFJDXZZHFNFLV-GFCCVEGCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-penflufen (CHEBI:83136) is a 5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide (CHEBI:83134) |
| (R)-penflufen (CHEBI:83136) is enantiomer of (S)-penflufen (CHEBI:83135) |
| Incoming Relation(s) |
| penflufen (CHEBI:83133) has part (R)-penflufen (CHEBI:83136) |
| (S)-penflufen (CHEBI:83135) is enantiomer of (R)-penflufen (CHEBI:83136) |
| IUPAC Name |
|---|
| 5-fluoro-1,3-dimethyl-N-{2-[(2R)-4-methylpentan-2-yl]phenyl}-1H-pyrazole-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12363233 | Reaxys |