EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H56N6O13 |
| Net Charge | 0 |
| Average Mass | 768.862 |
| Monoisotopic Mass | 768.39054 |
| SMILES | [H][C@@]1(CCCN(O)C(=O)/C=C(\C)CCO)NC(=O)[C@]([H])(CCCN(O)C(=O)/C=C(\C)CCOC(=O)[C@H](CCCN(O)C(=O)/C=C(\C)CCO)NC(C)=O)NC1=O |
| InChI | InChI=1S/C35H56N6O13/c1-23(11-17-42)20-30(45)39(51)14-5-8-27-33(48)38-28(34(49)37-27)9-6-15-40(52)32(47)22-25(3)13-19-54-35(50)29(36-26(4)44)10-7-16-41(53)31(46)21-24(2)12-18-43/h20-22,27-29,42-43,51-53H,5-19H2,1-4H3,(H,36,44)(H,37,49)(H,38,48)/b23-20+,24-21+,25-22+/t27-,28-,29-/m0/s1 |
| InChIKey | AKLLFACZGZTMGS-FCRFISLRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferricoprogen (CHEBI:83125) has role siderophore (CHEBI:26672) |
| desferricoprogen (CHEBI:83125) is a 2,5-diketopiperazines (CHEBI:65061) |
| desferricoprogen (CHEBI:83125) is a acetamides (CHEBI:22160) |
| desferricoprogen (CHEBI:83125) is a carboxylic ester (CHEBI:33308) |
| desferricoprogen (CHEBI:83125) is a homoallylic alcohol (CHEBI:134362) |
| desferricoprogen (CHEBI:83125) is a hydroxamic acid (CHEBI:24650) |
| desferricoprogen (CHEBI:83125) is a primary alcohol (CHEBI:15734) |
| desferricoprogen (CHEBI:83125) is conjugate acid of desferricoprogen(3−) (CHEBI:83127) |
| Incoming Relation(s) |
| desferricoprogen(3−) (CHEBI:83127) is conjugate base of desferricoprogen (CHEBI:83125) |
| IUPAC Name |
|---|
| (3E)-5-(hydroxy{3-[(2S,5S)-5-(3-{hydroxy[(2E)-5-hydroxy-3-methylpent-2-enoyl]amino}propyl)-3,6-dioxopiperazin-2-yl]propyl}amino)-3-methyl-5-oxopent-3-en-1-yl N2-acetyl-N5-hydroxy-N5-[(2E)-5-hydroxy-3-methylpent-2-enoyl]-L-ornithinate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21959939 | Reaxys |