EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O3 |
| Net Charge | 0 |
| Average Mass | 350.418 |
| Monoisotopic Mass | 350.16304 |
| SMILES | [H]/C(C)=C1\CN2[C@@]3([H])C[C@@]1([H])[C@@](C=O)(C(=O)OC)[C@]2([H])Cc1c3nc2ccccc12 |
| InChI | InChI=1S/C21H22N2O3/c1-3-12-10-23-17-9-15(12)21(11-24,20(25)26-2)18(23)8-14-13-6-4-5-7-16(13)22-19(14)17/h3-7,11,15,17-18,22H,8-10H2,1-2H3/b12-3-/t15-,17+,18+,21-/m1/s1 |
| InChIKey | BRJNQOSDCDNITN-VDMSZYBVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyneuridine aldehyde (CHEBI:16829) has functional parent sarpagine (CHEBI:9036) |
| polyneuridine aldehyde (CHEBI:16829) is a aldehyde (CHEBI:17478) |
| polyneuridine aldehyde (CHEBI:16829) is a alkaloid ester (CHEBI:38481) |
| polyneuridine aldehyde (CHEBI:16829) is a methyl ester (CHEBI:25248) |
| polyneuridine aldehyde (CHEBI:16829) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| methyl (15α,16R,19E)-17-oxosarpagan-16-carboxylate |
| Synonym | Source |
|---|---|
| Polyneuridine aldehyde | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| polyneuridine aldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00051791 | KNApSAcK |
| C11632 | KEGG COMPOUND |
| FDB031124 | FooDB |
| POLYNEURIDINE-ALDEHYDE | MetaCyc |
| Citations |
|---|